C30H40O4Si — CID 10918000
[(2S)-1-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl] (E)-4,4-dimethyl-5-oxohept-2-enoate (PubChem CID 10918000) has the molecular formula C30H40O4Si and a molecular weight of 492.73 g/mol. Its IUPAC name is [(2S)-1-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl] (E)-4,4-dimethyl-5-oxohept-2-enoate.
| Compound Name | [(2S)-1-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl] (E)-4,4-dimethyl-5-oxohept-2-enoate |
|---|---|
| PubChem CID | 10918000 |
| Molecular Formula | C30H40O4Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | [(2S)-1-[tert-butyl(diphenyl)silyl]oxypent-4-en-2-yl] (E)-4,4-dimethyl-5-oxohept-2-enoate |
| SMILES | C=CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)/C=C/C(C)(C)C(=O)CC |
| InChI | InChI=1S/C30H40O4Si/c1-8-16-24(34-28(32)21-22-30(6,7)27(31)9-2)23-33-35(29(3,4)5,25-17-12-10-13-18-25)26-19-14-11-15-20-26/h8,10-15,17-22,24H,1,9,16,23H2,2-7H3/b22-21+/t24-/m0/s1 |
| InChIKey | QWDCETJKWZVYSJ-JVAQPQQASA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|