C20H26O6 — CID 24755712
[(1R,2S)-1-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]-2-(methoxymethoxy)but-3-enyl] prop-2-enoate (PubChem CID 24755712) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [(1R,2S)-1-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]-2-(methoxymethoxy)but-3-enyl] prop-2-enoate.
| Compound Name | [(1R,2S)-1-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]-2-(methoxymethoxy)but-3-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 24755712 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(1R,2S)-1-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]-2-(methoxymethoxy)but-3-enyl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H]([C@@H]1OC(C)(C)O[C@H]1c1ccccc1)[C@H](C=C)OCOC |
| InChI | InChI=1S/C20H26O6/c1-6-15(23-13-22-5)18(24-16(21)7-2)19-17(25-20(3,4)26-19)14-11-9-8-10-12-14/h6-12,15,17-19H,1-2,13H2,3-5H3/t15-,17-,18+,19+/m0/s1 |
| InChIKey | VFYSOKPBPOLTTA-GDAAHCPNSA-N |
| XLogP | 3.15 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|