C33H50O4Si2 — CID 11541417
tert-butyl-[2-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoxy]-diphenylsilane (PubChem CID 11541417) has the molecular formula C33H50O4Si2 and a molecular weight of 566.93 g/mol. Its IUPAC name is tert-butyl-[2-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11541417 |
| Molecular Formula | C33H50O4Si2 |
| Molecular Weight | 566.93 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | tert-butyl-[2-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoxy]-diphenylsilane |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@@H]1C(=C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H50O4Si2/c1-13-28(37-38(11,12)31(3,4)5)30-29(35-33(9,10)36-30)25(2)24-34-39(32(6,7)8,26-20-16-14-17-21-26)27-22-18-15-19-23-27/h13-23,28-30H,1-2,24H2,3-12H3/t28-,29-,30+/m1/s1 |
| InChIKey | FTIVNJDCPDGAAR-OCBJUFRSSA-N |
| XLogP | 7.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.93 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|