C13H16N2O6 — CID 13270952
5-nitro-5-(2-nitropropan-2-yl)-2-phenyl-1,3-dioxane (PubChem CID 13270952) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is 5-nitro-5-(2-nitropropan-2-yl)-2-phenyl-1,3-dioxane.
| Compound Name | 5-nitro-5-(2-nitropropan-2-yl)-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 13270952 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 5-nitro-5-(2-nitropropan-2-yl)-2-phenyl-1,3-dioxane |
| SMILES | CC(C)([N+](=O)[O-])C1([N+](=O)[O-])COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C13H16N2O6/c1-12(2,14(16)17)13(15(18)19)8-20-11(21-9-13)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | OSUVNWOTCTUWPG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|