C29H45IO6Si — CID 171561790
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(2S,4R,5S)-5-[(1E,3S,4S,5E)-4-hydroxy-6-iodo-3,5-dimethylhexa-1,5-dienyl]-4-methyl-2-phenyl-1,3-dioxolan-4-yl]pentanoic acid (PubChem CID 171561790) has the molecular formula C29H45IO6Si and a molecular weight of 644.66 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(2S,4R,5S)-5-[(1E,3S,4S,5E)-4-hydroxy-6-iodo-3,5-dimethylhexa-1,5-dienyl]-4-methyl-2-phenyl-1,3-dioxolan-4-yl]pentanoic acid.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(2S,4R,5S)-5-[(1E,3S,4S,5E)-4-hydroxy-6-iodo-3,5-dimethylhexa-1,5-dienyl]-4-methyl-2-phenyl-1,3-dioxolan-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 171561790 |
| Molecular Formula | C29H45IO6Si |
| Molecular Weight | 644.66 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(2S,4R,5S)-5-[(1E,3S,4S,5E)-4-hydroxy-6-iodo-3,5-dimethylhexa-1,5-dienyl]-4-methyl-2-phenyl-1,3-dioxolan-4-yl]pentanoic acid |
| SMILES | C/C(=C\I)[C@@H](O)[C@@H](C)/C=C/[C@@H]1O[C@H](c2ccccc2)O[C@]1(C)CC[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H45IO6Si/c1-20(26(33)21(2)19-30)14-15-24-29(6,35-27(34-24)22-12-10-9-11-13-22)17-16-23(18-25(31)32)36-37(7,8)28(3,4)5/h9-15,19-20,23-24,26-27,33H,16-18H2,1-8H3,(H,31,32)/b15-14+,21-19+/t20-,23+,24-,26-,27-,29+/m0/s1 |
| InChIKey | XPVGXEIVSCSRAV-WUUQLBNOSA-N |
| XLogP | 7.40 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.66 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|