C31H49NO6SSi — CID 123189987
(5S)-5-tert-butyl-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R,5S)-5-ethenyl-2-(4-methoxyphenyl)-4-methyl-1,3-dioxolan-4-yl]pentanoyl]-1,3-thiazolidin-2-one (PubChem CID 123189987) has the molecular formula C31H49NO6SSi and a molecular weight of 591.89 g/mol. Its IUPAC name is (5S)-5-tert-butyl-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R,5S)-5-ethenyl-2-(4-methoxyphenyl)-4-methyl-1,3-dioxolan-4-yl]pentanoyl]-1,3-thiazolidin-2-one.
| Compound Name | (5S)-5-tert-butyl-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R,5S)-5-ethenyl-2-(4-methoxyphenyl)-4-methyl-1,3-dioxolan-4-yl]pentanoyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 123189987 |
| Molecular Formula | C31H49NO6SSi |
| Molecular Weight | 591.89 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | (5S)-5-tert-butyl-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R,5S)-5-ethenyl-2-(4-methoxyphenyl)-4-methyl-1,3-dioxolan-4-yl]pentanoyl]-1,3-thiazolidin-2-one |
| SMILES | C=C[C@@H]1OC(c2ccc(OC)cc2)O[C@]1(C)CC[C@H](CC(=O)N1C[C@H](C(C)(C)C)SC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H49NO6SSi/c1-12-24-31(8,37-27(36-24)21-13-15-22(35-9)16-14-21)18-17-23(38-40(10,11)30(5,6)7)19-26(33)32-20-25(29(2,3)4)39-28(32)34/h12-16,23-25,27H,1,17-20H2,2-11H3/t23-,24+,25-,27?,31-/m1/s1 |
| InChIKey | LUTHWQHPEBFUQZ-OELNVJBRSA-N |
| XLogP | 7.72 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.89 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|