C35H66O7Si3 — CID 139249855
(2S)-2-[(2R,4R,6S)-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde (PubChem CID 139249855) has the molecular formula C35H66O7Si3 and a molecular weight of 683.16 g/mol. Its IUPAC name is (2S)-2-[(2R,4R,6S)-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde.
| Compound Name | (2S)-2-[(2R,4R,6S)-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde |
|---|---|
| PubChem CID | 139249855 |
| Molecular Formula | C35H66O7Si3 |
| Molecular Weight | 683.16 g/mol |
| Exact Mass | 682.41 |
| IUPAC Name | (2S)-2-[(2R,4R,6S)-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde |
| SMILES | COc1ccc([C@@H]2O[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)C[C@H]([C@@H](C=O)O[Si](C)(C)C(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C35H66O7Si3/c1-25(40-43(12,13)33(2,3)4)29(41-44(14,15)34(5,6)7)22-28-23-30(31(24-36)42-45(16,17)35(8,9)10)39-32(38-28)26-18-20-27(37-11)21-19-26/h18-21,24-25,28-32H,22-23H2,1-17H3/t25-,28-,29-,30-,31-,32-/m1/s1 |
| InChIKey | GEUADIKKCLHUSN-XMPJBLIUSA-N |
| XLogP | 9.65 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.16 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|