C24H42O4Si — CID 11732597
tert-butyl-[3-[(2R,4R,5S,6S)-2-(4-methoxyphenyl)-5-methyl-6-propan-2-yl-1,3-dioxan-4-yl]propoxy]-dimethylsilane (PubChem CID 11732597) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is tert-butyl-[3-[(2R,4R,5S,6S)-2-(4-methoxyphenyl)-5-methyl-6-propan-2-yl-1,3-dioxan-4-yl]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[(2R,4R,5S,6S)-2-(4-methoxyphenyl)-5-methyl-6-propan-2-yl-1,3-dioxan-4-yl]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11732597 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | tert-butyl-[3-[(2R,4R,5S,6S)-2-(4-methoxyphenyl)-5-methyl-6-propan-2-yl-1,3-dioxan-4-yl]propoxy]-dimethylsilane |
| SMILES | COc1ccc([C@@H]2O[C@H](CCCO[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](C(C)C)O2)cc1 |
| InChI | InChI=1S/C24H42O4Si/c1-17(2)22-18(3)21(11-10-16-26-29(8,9)24(4,5)6)27-23(28-22)19-12-14-20(25-7)15-13-19/h12-15,17-18,21-23H,10-11,16H2,1-9H3/t18-,21+,22-,23+/m0/s1 |
| InChIKey | PQRAYXGFPPVQGP-OUFMZXHOSA-N |
| XLogP | 6.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|