C21H34F2O2SSi — CID 162623282
tert-butyl-[(6R)-8,8-difluoro-6-(4-methoxyphenyl)sulfanyloct-7-enoxy]-dimethylsilane (PubChem CID 162623282) has the molecular formula C21H34F2O2SSi and a molecular weight of 416.65 g/mol. Its IUPAC name is tert-butyl-[(6R)-8,8-difluoro-6-(4-methoxyphenyl)sulfanyloct-7-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(6R)-8,8-difluoro-6-(4-methoxyphenyl)sulfanyloct-7-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 162623282 |
| Molecular Formula | C21H34F2O2SSi |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | tert-butyl-[(6R)-8,8-difluoro-6-(4-methoxyphenyl)sulfanyloct-7-enoxy]-dimethylsilane |
| SMILES | COc1ccc(S[C@@H](C=C(F)F)CCCCCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H34F2O2SSi/c1-21(2,3)27(5,6)25-15-9-7-8-10-19(16-20(22)23)26-18-13-11-17(24-4)12-14-18/h11-14,16,19H,7-10,15H2,1-6H3/t19-/m1/s1 |
| InChIKey | WYLVOYCQSZLHOB-LJQANCHMSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|