About 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole
3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole (PubChem CID 162623316) has the molecular formula C22H23F2NOS
and a molecular weight of 387.50 g/mol. Its IUPAC name is 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole.
Molecular Properties
| Compound Name | 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole |
| PubChem CID | 162623316 |
| Molecular Formula | C22H23F2NOS |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole |
| SMILES | COc1ccc(S[C@@H](C=C(F)F)CCCc2cn(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H23F2NOS/c1-25-15-16(20-8-3-4-9-21(20)25)6-5-7-19(14-22(23)24)27-18-12-10-17(26-2)11-13-18/h3-4,8-15,19H,5-7H2,1-2H3/t19-/m1/s1 |
| InChIKey | RWXRXXUAMSHVPN-LJQANCHMSA-N |
| XLogP | 6.45 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole?
The IUPAC name of 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole (CID 162623316) is 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole.
What is the SMILES notation for 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole?
The canonical SMILES for 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole is COc1ccc(S[C@@H](C=C(F)F)CCCc2cn(C)c3ccccc23)cc1.
What is the InChIKey of 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole?
The InChIKey is RWXRXXUAMSHVPN-LJQANCHMSA-N. The full InChI is InChI=1S/C22H23F2NOS/c1-25-15-16(20-8-3-4-9-21(20)25)6-5-7-19(14-22(23)24)27-18-12-10-17(26-2)11-13-18/h3-4,8-15,19H,5-7H2,1-2H3/t19-/m1/s1.
What are the key properties of 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole?
3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole has a molecular weight of 387.50 g/mol, XLogP of 6.45, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4R)-6,6-difluoro-4-(4-methoxyphenyl)sulfanylhex-5-enyl]-1-methylindole is sourced from PubChem (CID 162623316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).