C23H34O2SSi — CID 135029835
tert-butyl-[4-(4-methoxyphenyl)-4-phenylsulfanylbutoxy]-dimethylsilane (PubChem CID 135029835) has the molecular formula C23H34O2SSi and a molecular weight of 402.68 g/mol. Its IUPAC name is tert-butyl-[4-(4-methoxyphenyl)-4-phenylsulfanylbutoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-(4-methoxyphenyl)-4-phenylsulfanylbutoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135029835 |
| Molecular Formula | C23H34O2SSi |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | tert-butyl-[4-(4-methoxyphenyl)-4-phenylsulfanylbutoxy]-dimethylsilane |
| SMILES | COc1ccc(C(CCCO[Si](C)(C)C(C)(C)C)Sc2ccccc2)cc1 |
| InChI | InChI=1S/C23H34O2SSi/c1-23(2,3)27(5,6)25-18-10-13-22(26-21-11-8-7-9-12-21)19-14-16-20(24-4)17-15-19/h7-9,11-12,14-17,22H,10,13,18H2,1-6H3 |
| InChIKey | REWLYGYSAGOZJR-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|