C26H47BO4Si — CID 154585596
tert-butyl-[(4R)-7-(4-methoxyphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptoxy]-dimethylsilane (PubChem CID 154585596) has the molecular formula C26H47BO4Si and a molecular weight of 462.56 g/mol. Its IUPAC name is tert-butyl-[(4R)-7-(4-methoxyphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4R)-7-(4-methoxyphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154585596 |
| Molecular Formula | C26H47BO4Si |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | tert-butyl-[(4R)-7-(4-methoxyphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptoxy]-dimethylsilane |
| SMILES | COc1ccc(CCC[C@H](CCCO[Si](C)(C)C(C)(C)C)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C26H47BO4Si/c1-24(2,3)32(9,10)29-20-12-15-22(27-30-25(4,5)26(6,7)31-27)14-11-13-21-16-18-23(28-8)19-17-21/h16-19,22H,11-15,20H2,1-10H3/t22-/m1/s1 |
| InChIKey | JSHLTWXTOLEHPZ-JOCHJYFZSA-N |
| XLogP | 7.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|