C29H42O5SSi — CID 11752918
[(2R,4aR,6S,7R,8aS)-2-(4-methoxyphenyl)-6-(3-phenylsulfanylpropyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11752918) has the molecular formula C29H42O5SSi and a molecular weight of 530.80 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8aS)-2-(4-methoxyphenyl)-6-(3-phenylsulfanylpropyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,4aR,6S,7R,8aS)-2-(4-methoxyphenyl)-6-(3-phenylsulfanylpropyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11752918 |
| Molecular Formula | C29H42O5SSi |
| Molecular Weight | 530.80 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | [(2R,4aR,6S,7R,8aS)-2-(4-methoxyphenyl)-6-(3-phenylsulfanylpropyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COc1ccc([C@@H]2OC[C@H]3O[C@@H](CCCSc4ccccc4)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]3O2)cc1 |
| InChI | InChI=1S/C29H42O5SSi/c1-29(2,3)36(5,6)34-26-19-25-27(20-31-28(33-25)21-14-16-22(30-4)17-15-21)32-24(26)13-10-18-35-23-11-8-7-9-12-23/h7-9,11-12,14-17,24-28H,10,13,18-20H2,1-6H3/t24-,25-,26+,27+,28+/m0/s1 |
| InChIKey | SMSGFTBUMSWIPK-UZSVIBPSSA-N |
| XLogP | 7.23 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.80 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|