C29H48O7Si — CID 15965856
3-[(1R,3S,6S,8R,11S,13R,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-(4-methoxyphenyl)-14-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-13-yl]propan-1-ol (PubChem CID 15965856) has the molecular formula C29H48O7Si and a molecular weight of 536.78 g/mol. Its IUPAC name is 3-[(1R,3S,6S,8R,11S,13R,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-(4-methoxyphenyl)-14-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-13-yl]propan-1-ol.
| Compound Name | 3-[(1R,3S,6S,8R,11S,13R,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-(4-methoxyphenyl)-14-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-13-yl]propan-1-ol |
|---|---|
| PubChem CID | 15965856 |
| Molecular Formula | C29H48O7Si |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | 3-[(1R,3S,6S,8R,11S,13R,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-(4-methoxyphenyl)-14-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecan-13-yl]propan-1-ol |
| SMILES | COc1ccc([C@H]2OC[C@@H]3O[C@@H]4CC[C@](C)(O[Si](C)(C)C(C)(C)C)[C@@H](CCCO)O[C@H]4CC[C@H]3O2)cc1 |
| InChI | InChI=1S/C29H48O7Si/c1-28(2,3)37(6,7)36-29(4)17-16-24-22(34-26(29)9-8-18-30)14-15-23-25(33-24)19-32-27(35-23)20-10-12-21(31-5)13-11-20/h10-13,22-27,30H,8-9,14-19H2,1-7H3/t22-,23+,24+,25-,26+,27-,29-/m0/s1 |
| InChIKey | BABCQKGKCQJJRU-JXYPADOKSA-N |
| XLogP | 5.76 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|