C19H28O5 — CID 102317710
(2R,6S,7R)-6-ethyl-2-(4-methoxyphenyl)-4a,6,7,8,9,10,11,11a-octahydro-4H-[1,3]dioxino[5,4-b]oxonin-7-ol (PubChem CID 102317710) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (2R,6S,7R)-6-ethyl-2-(4-methoxyphenyl)-4a,6,7,8,9,10,11,11a-octahydro-4H-[1,3]dioxino[5,4-b]oxonin-7-ol.
| Compound Name | (2R,6S,7R)-6-ethyl-2-(4-methoxyphenyl)-4a,6,7,8,9,10,11,11a-octahydro-4H-[1,3]dioxino[5,4-b]oxonin-7-ol |
|---|---|
| PubChem CID | 102317710 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (2R,6S,7R)-6-ethyl-2-(4-methoxyphenyl)-4a,6,7,8,9,10,11,11a-octahydro-4H-[1,3]dioxino[5,4-b]oxonin-7-ol |
| SMILES | CC[C@@H]1OC2CO[C@@H](c3ccc(OC)cc3)OC2CCCC[C@H]1O |
| InChI | InChI=1S/C19H28O5/c1-3-16-15(20)6-4-5-7-17-18(23-16)12-22-19(24-17)13-8-10-14(21-2)11-9-13/h8-11,15-20H,3-7,12H2,1-2H3/t15-,16+,17?,18?,19-/m1/s1 |
| InChIKey | PKGBCFSQHNSMRC-MAQDGTSESA-N |
| XLogP | 3.21 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |