C14H19NO3 — CID 67372159
(7aS)-2-(4-methoxyphenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]dioxin-6-amine (PubChem CID 67372159) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (7aS)-2-(4-methoxyphenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]dioxin-6-amine.
| Compound Name | (7aS)-2-(4-methoxyphenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]dioxin-6-amine |
|---|---|
| PubChem CID | 67372159 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (7aS)-2-(4-methoxyphenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]dioxin-6-amine |
| SMILES | COc1ccc(C2OCC3CC(N)C[C@@H]3O2)cc1 |
| InChI | InChI=1S/C14H19NO3/c1-16-12-4-2-9(3-5-12)14-17-8-10-6-11(15)7-13(10)18-14/h2-5,10-11,13-14H,6-8,15H2,1H3/t10?,11?,13-,14?/m0/s1 |
| InChIKey | PHQFLYYEVIKWBB-QHNNHONCSA-N |
| XLogP | 1.85 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |