C21H22IN3O3 — CID 58944673
7-[(4aS,6R,7aS)-2-(4-methoxyphenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]dioxin-6-yl]-5-iodo-4-methylpyrrolo[2,3-d]pyrimidine (PubChem CID 58944673) has the molecular formula C21H22IN3O3 and a molecular weight of 491.33 g/mol. Its IUPAC name is 7-[(4aS,6R,7aS)-2-(4-methoxyphenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]dioxin-6-yl]-5-iodo-4-methylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-[(4aS,6R,7aS)-2-(4-methoxyphenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]dioxin-6-yl]-5-iodo-4-methylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 58944673 |
| Molecular Formula | C21H22IN3O3 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | 7-[(4aS,6R,7aS)-2-(4-methoxyphenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]dioxin-6-yl]-5-iodo-4-methylpyrrolo[2,3-d]pyrimidine |
| SMILES | COc1ccc(C2OC[C@@H]3C[C@@H](n4cc(I)c5c(C)ncnc54)C[C@@H]3O2)cc1 |
| InChI | InChI=1S/C21H22IN3O3/c1-12-19-17(22)9-25(20(19)24-11-23-12)15-7-14-10-27-21(28-18(14)8-15)13-3-5-16(26-2)6-4-13/h3-6,9,11,14-15,18,21H,7-8,10H2,1-2H3/t14-,15+,18-,21?/m0/s1 |
| InChIKey | JMEMHQCMJLDMFY-OVQKXHPUSA-N |
| XLogP | 4.42 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|