About (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine
(5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine (PubChem CID 137402666) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine.
Molecular Properties
| Compound Name | (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine |
| PubChem CID | 137402666 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine |
| SMILES | C#CC1OC(c2ccc(OC)cc2)OC[C@@H]1N |
| InChI | InChI=1S/C13H15NO3/c1-3-12-11(14)8-16-13(17-12)9-4-6-10(15-2)7-5-9/h1,4-7,11-13H,8,14H2,2H3/t11-,12?,13?/m0/s1 |
| InChIKey | LSJJQJACDWLABM-HIFPTAJRSA-N |
| XLogP | 1.07 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine?
The IUPAC name of (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine (CID 137402666) is (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine.
What is the SMILES notation for (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine?
The canonical SMILES for (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine is C#CC1OC(c2ccc(OC)cc2)OC[C@@H]1N.
What is the InChIKey of (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine?
The InChIKey is LSJJQJACDWLABM-HIFPTAJRSA-N. The full InChI is InChI=1S/C13H15NO3/c1-3-12-11(14)8-16-13(17-12)9-4-6-10(15-2)7-5-9/h1,4-7,11-13H,8,14H2,2H3/t11-,12?,13?/m0/s1.
What are the key properties of (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine?
(5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine has a molecular weight of 233.27 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-4-ethynyl-2-(4-methoxyphenyl)-1,3-dioxan-5-amine is sourced from PubChem (CID 137402666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).