C32H54O5Si — CID 102050106
(1R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,4R)-2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxan-4-yl]tridec-3-yn-6-ol (PubChem CID 102050106) has the molecular formula C32H54O5Si and a molecular weight of 546.87 g/mol. Its IUPAC name is (1R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,4R)-2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxan-4-yl]tridec-3-yn-6-ol.
| Compound Name | (1R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,4R)-2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxan-4-yl]tridec-3-yn-6-ol |
|---|---|
| PubChem CID | 102050106 |
| Molecular Formula | C32H54O5Si |
| Molecular Weight | 546.87 g/mol |
| Exact Mass | 546.37 |
| IUPAC Name | (1R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,4R)-2-(4-methoxyphenyl)-5,5-dimethyl-1,3-dioxan-4-yl]tridec-3-yn-6-ol |
| SMILES | CCCCCCC[C@@H](O)CC#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H](c2ccc(OC)cc2)OCC1(C)C |
| InChI | InChI=1S/C32H54O5Si/c1-10-11-12-13-14-17-26(33)18-15-16-19-28(37-38(8,9)31(2,3)4)29-32(5,6)24-35-30(36-29)25-20-22-27(34-7)23-21-25/h20-23,26,28-30,33H,10-14,17-19,24H2,1-9H3/t26-,28-,29+,30+/m1/s1 |
| InChIKey | XSMQXQFHALBXKN-OKCNIUFZSA-N |
| XLogP | 8.03 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.87 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|