C20H40O4Si — CID 10894040
(2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-12,12-dimethoxydodec-3-yn-6-ol (PubChem CID 10894040) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is (2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-12,12-dimethoxydodec-3-yn-6-ol.
| Compound Name | (2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-12,12-dimethoxydodec-3-yn-6-ol |
|---|---|
| PubChem CID | 10894040 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-12,12-dimethoxydodec-3-yn-6-ol |
| SMILES | COC(CCCCC[C@@H](O)CC#C[C@H](C)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C20H40O4Si/c1-17(24-25(7,8)20(2,3)4)13-12-15-18(21)14-10-9-11-16-19(22-5)23-6/h17-19,21H,9-11,14-16H2,1-8H3/t17-,18+/m0/s1 |
| InChIKey | WGNXKNXUMAOYFX-ZWKOTPCHSA-N |
| XLogP | 4.72 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|