C24H42O2Si — CID 10385752
(9S)-1-[tert-butyl(dimethyl)silyl]oxyoctadec-17-en-4,6-diyn-9-ol (PubChem CID 10385752) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is (9S)-1-[tert-butyl(dimethyl)silyl]oxyoctadec-17-en-4,6-diyn-9-ol.
| Compound Name | (9S)-1-[tert-butyl(dimethyl)silyl]oxyoctadec-17-en-4,6-diyn-9-ol |
|---|---|
| PubChem CID | 10385752 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | (9S)-1-[tert-butyl(dimethyl)silyl]oxyoctadec-17-en-4,6-diyn-9-ol |
| SMILES | C=CCCCCCCC[C@H](O)CC#CC#CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H42O2Si/c1-7-8-9-10-11-14-17-20-23(25)21-18-15-12-13-16-19-22-26-27(5,6)24(2,3)4/h7,23,25H,1,8-11,14,16-17,19-22H2,2-6H3/t23-/m0/s1 |
| InChIKey | QTSJPWKJABIRDL-QHCPKHFHSA-N |
| XLogP | 6.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|