C31H54O8Si2 — CID 177388527
(4S)-4-[(1S,2R,3R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(4-methoxyphenoxy)-3-methyl-2-triethylsilyloxyhept-6-enyl]-4-methyl-1,3-dioxolan-2-one (PubChem CID 177388527) has the molecular formula C31H54O8Si2 and a molecular weight of 610.94 g/mol. Its IUPAC name is (4S)-4-[(1S,2R,3R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(4-methoxyphenoxy)-3-methyl-2-triethylsilyloxyhept-6-enyl]-4-methyl-1,3-dioxolan-2-one.
| Compound Name | (4S)-4-[(1S,2R,3R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(4-methoxyphenoxy)-3-methyl-2-triethylsilyloxyhept-6-enyl]-4-methyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 177388527 |
| Molecular Formula | C31H54O8Si2 |
| Molecular Weight | 610.94 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | (4S)-4-[(1S,2R,3R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(4-methoxyphenoxy)-3-methyl-2-triethylsilyloxyhept-6-enyl]-4-methyl-1,3-dioxolan-2-one |
| SMILES | C=C[C@@H](Oc1ccc(OC)cc1)C(O)[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@H](O[Si](C)(C)C(C)(C)C)[C@]1(C)COC(=O)O1 |
| InChI | InChI=1S/C31H54O8Si2/c1-13-25(36-24-19-17-23(34-10)18-20-24)26(32)22(5)27(38-41(14-2,15-3)16-4)28(31(9)21-35-29(33)37-31)39-40(11,12)30(6,7)8/h13,17-20,22,25-28,32H,1,14-16,21H2,2-12H3/t22-,25-,26?,27-,28+,31+/m1/s1 |
| InChIKey | DLEBXYQSBZFWMV-NQUSZTDDSA-N |
| XLogP | 7.33 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.94 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|