C27H46O6Si — CID 10672851
(3S,4R,5S,6R)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]-6-methyl-4-triethylsilyloxyhept-1-en-3-ol (PubChem CID 10672851) has the molecular formula C27H46O6Si and a molecular weight of 494.75 g/mol. Its IUPAC name is (3S,4R,5S,6R)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]-6-methyl-4-triethylsilyloxyhept-1-en-3-ol.
| Compound Name | (3S,4R,5S,6R)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]-6-methyl-4-triethylsilyloxyhept-1-en-3-ol |
|---|---|
| PubChem CID | 10672851 |
| Molecular Formula | C27H46O6Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | (3S,4R,5S,6R)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]-6-methyl-4-triethylsilyloxyhept-1-en-3-ol |
| SMILES | C=C[C@H](O)[C@@H](O[Si](CC)(CC)CC)[C@@H](OCc1ccc(OC)cc1)[C@H](C)C[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C27H46O6Si/c1-9-24(28)26(33-34(10-2,11-3)12-4)25(20(5)17-23-19-31-27(6,7)32-23)30-18-21-13-15-22(29-8)16-14-21/h9,13-16,20,23-26,28H,1,10-12,17-19H2,2-8H3/t20-,23-,24+,25+,26-/m1/s1 |
| InChIKey | GVNMDMJPJQVBFP-VBSLVYFZSA-N |
| XLogP | 5.70 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|