C34H56O4Si — CID 11103666
(2E,4R,5S,6E,8E,10S,11R,12S)-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethyl-5-triethylsilyloxytetradeca-2,6,8-trienal (PubChem CID 11103666) has the molecular formula C34H56O4Si and a molecular weight of 556.90 g/mol. Its IUPAC name is (2E,4R,5S,6E,8E,10S,11R,12S)-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethyl-5-triethylsilyloxytetradeca-2,6,8-trienal.
| Compound Name | (2E,4R,5S,6E,8E,10S,11R,12S)-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethyl-5-triethylsilyloxytetradeca-2,6,8-trienal |
|---|---|
| PubChem CID | 11103666 |
| Molecular Formula | C34H56O4Si |
| Molecular Weight | 556.90 g/mol |
| Exact Mass | 556.39 |
| IUPAC Name | (2E,4R,5S,6E,8E,10S,11R,12S)-11-[(4-methoxyphenyl)methoxy]-2,4,6,8,10,12-hexamethyl-5-triethylsilyloxytetradeca-2,6,8-trienal |
| SMILES | CC[C@H](C)[C@@H](OCc1ccc(OC)cc1)[C@@H](C)/C=C(C)/C=C(\C)[C@@H](O[Si](CC)(CC)CC)[C@H](C)/C=C(\C)C=O |
| InChI | InChI=1S/C34H56O4Si/c1-12-27(7)33(37-24-31-16-18-32(36-11)19-17-31)28(8)20-25(5)21-29(9)34(30(10)22-26(6)23-35)38-39(13-2,14-3)15-4/h16-23,27-28,30,33-34H,12-15,24H2,1-11H3/b25-20+,26-22+,29-21+/t27-,28-,30+,33+,34+/m0/s1 |
| InChIKey | LZXIPCBDWGGUEW-HZCPKNIISA-N |
| XLogP | 9.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.90 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|