C30H48O3 — CID 15508045
(2E,4E,6R,7R,8S)-7-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethyloctadeca-2,4-dienal (PubChem CID 15508045) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is (2E,4E,6R,7R,8S)-7-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethyloctadeca-2,4-dienal.
| Compound Name | (2E,4E,6R,7R,8S)-7-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethyloctadeca-2,4-dienal |
|---|---|
| PubChem CID | 15508045 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | (2E,4E,6R,7R,8S)-7-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethyloctadeca-2,4-dienal |
| SMILES | CCCCCCCCCC[C@H](C)[C@@H](OCc1ccc(OC)cc1)[C@H](C)/C=C(C)/C=C(\C)C=O |
| InChI | InChI=1S/C30H48O3/c1-7-8-9-10-11-12-13-14-15-26(4)30(27(5)21-24(2)20-25(3)22-31)33-23-28-16-18-29(32-6)19-17-28/h16-22,26-27,30H,7-15,23H2,1-6H3/b24-21+,25-20+/t26-,27+,30+/m0/s1 |
| InChIKey | RIUHPTKPFBMHJN-MCSZQDSWSA-N |
| XLogP | 8.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|