C19H32O5 — CID 11667279
(2R,3S,4R)-7,7-dimethoxy-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptan-1-ol (PubChem CID 11667279) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is (2R,3S,4R)-7,7-dimethoxy-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptan-1-ol.
| Compound Name | (2R,3S,4R)-7,7-dimethoxy-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptan-1-ol |
|---|---|
| PubChem CID | 11667279 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (2R,3S,4R)-7,7-dimethoxy-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptan-1-ol |
| SMILES | COc1ccc(CO[C@H]([C@H](C)CO)[C@H](C)CCC(OC)OC)cc1 |
| InChI | InChI=1S/C19H32O5/c1-14(6-11-18(22-4)23-5)19(15(2)12-20)24-13-16-7-9-17(21-3)10-8-16/h7-10,14-15,18-20H,6,11-13H2,1-5H3/t14-,15-,19+/m1/s1 |
| InChIKey | XGCHTHWRUOVURT-CLCXKQKWSA-N |
| XLogP | 3.24 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|