C28H41NO4 — CID 102479875
(4S,5R)-5-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxytridecanamide (PubChem CID 102479875) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is (4S,5R)-5-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxytridecanamide.
| Compound Name | (4S,5R)-5-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxytridecanamide |
|---|---|
| PubChem CID | 102479875 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | (4S,5R)-5-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxytridecanamide |
| SMILES | CCCCCCCC[C@@H](O)[C@H](CCC(=O)NCc1ccc(OC)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C28H41NO4/c1-3-4-5-6-7-11-14-26(30)27(33-22-24-12-9-8-10-13-24)19-20-28(31)29-21-23-15-17-25(32-2)18-16-23/h8-10,12-13,15-18,26-27,30H,3-7,11,14,19-22H2,1-2H3,(H,29,31)/t26-,27+/m1/s1 |
| InChIKey | SAHQDHPSGKVYLK-SXOMAYOGSA-N |
| XLogP | 5.79 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|