C21H31NO5 — CID 10691000
4-[(4S)-1-(benzylamino)-1-oxodecan-4-yl]oxy-4-oxobutanoic acid (PubChem CID 10691000) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is 4-[(4S)-1-(benzylamino)-1-oxodecan-4-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[(4S)-1-(benzylamino)-1-oxodecan-4-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10691000 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 4-[(4S)-1-(benzylamino)-1-oxodecan-4-yl]oxy-4-oxobutanoic acid |
| SMILES | CCCCCC[C@@H](CCC(=O)NCc1ccccc1)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C21H31NO5/c1-2-3-4-8-11-18(27-21(26)15-14-20(24)25)12-13-19(23)22-16-17-9-6-5-7-10-17/h5-7,9-10,18H,2-4,8,11-16H2,1H3,(H,22,23)(H,24,25)/t18-/m0/s1 |
| InChIKey | XWDGODNRNXFTCH-SFHVURJKSA-N |
| XLogP | 3.83 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|