C21H27NO4 — CID 135020165
(4S,5R)-5-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxyhexanamide (PubChem CID 135020165) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (4S,5R)-5-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxyhexanamide.
| Compound Name | (4S,5R)-5-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxyhexanamide |
|---|---|
| PubChem CID | 135020165 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (4S,5R)-5-hydroxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxyhexanamide |
| SMILES | COc1ccc(CNC(=O)CC[C@H](OCc2ccccc2)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C21H27NO4/c1-16(23)20(26-15-18-6-4-3-5-7-18)12-13-21(24)22-14-17-8-10-19(25-2)11-9-17/h3-11,16,20,23H,12-15H2,1-2H3,(H,22,24)/t16-,20+/m1/s1 |
| InChIKey | AETVISZVQYQPQK-UZLBHIALSA-N |
| XLogP | 3.06 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |