C25H40O6 — CID 101424551
(4S)-4-[(1S,2R,5S,6R)-5-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-2,6-dimethyloct-7-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 101424551) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is (4S)-4-[(1S,2R,5S,6R)-5-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-2,6-dimethyloct-7-enyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(1S,2R,5S,6R)-5-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-2,6-dimethyloct-7-enyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 101424551 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (4S)-4-[(1S,2R,5S,6R)-5-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxy]-2,6-dimethyloct-7-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=C[C@@H](C)[C@H](CC[C@@H](C)[C@H](OCc1ccc(OC)cc1)[C@@H]1COC(C)(C)O1)OCOC |
| InChI | InChI=1S/C25H40O6/c1-8-18(2)22(29-17-26-6)14-9-19(3)24(23-16-30-25(4,5)31-23)28-15-20-10-12-21(27-7)13-11-20/h8,10-13,18-19,22-24H,1,9,14-17H2,2-7H3/t18-,19-,22+,23+,24+/m1/s1 |
| InChIKey | JUFCPEJFJRHZJP-PGEXYDAJSA-N |
| XLogP | 4.96 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|