C31H51BrO8Si — CID 11411232
2-bromoethyl [(2S,3R,4R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(2R,3R)-3-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2-methyloxiran-2-yl]methyl]-3-hydroxy-4-methylhex-5-enyl] carbonate (PubChem CID 11411232) has the molecular formula C31H51BrO8Si and a molecular weight of 659.73 g/mol. Its IUPAC name is 2-bromoethyl [(2S,3R,4R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(2R,3R)-3-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2-methyloxiran-2-yl]methyl]-3-hydroxy-4-methylhex-5-enyl] carbonate.
| Compound Name | 2-bromoethyl [(2S,3R,4R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(2R,3R)-3-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2-methyloxiran-2-yl]methyl]-3-hydroxy-4-methylhex-5-enyl] carbonate |
|---|---|
| PubChem CID | 11411232 |
| Molecular Formula | C31H51BrO8Si |
| Molecular Weight | 659.73 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | 2-bromoethyl [(2S,3R,4R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(2R,3R)-3-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2-methyloxiran-2-yl]methyl]-3-hydroxy-4-methylhex-5-enyl] carbonate |
| SMILES | C=C[C@@H](C)[C@@H](O)[C@H](COC(=O)OCCBr)[C@H](O[Si](C)(C)C(C)(C)C)[C@]1(C)O[C@@H]1[C@@H](C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C31H51BrO8Si/c1-11-21(2)26(33)25(20-38-29(34)37-17-16-32)28(40-41(9,10)30(4,5)6)31(7)27(39-31)22(3)18-36-19-23-12-14-24(35-8)15-13-23/h11-15,21-22,25-28,33H,1,16-20H2,2-10H3/t21-,22+,25+,26-,27-,28+,31-/m1/s1 |
| InChIKey | VOYTZPILFYKIEX-NZQASILUSA-N |
| XLogP | 6.74 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.73 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|