C23H40O4Si — CID 135025916
(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]non-1-en-3-ol (PubChem CID 135025916) has the molecular formula C23H40O4Si and a molecular weight of 408.66 g/mol. Its IUPAC name is (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]non-1-en-3-ol.
| Compound Name | (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]non-1-en-3-ol |
|---|---|
| PubChem CID | 135025916 |
| Molecular Formula | C23H40O4Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-9-[(4-methoxyphenyl)methoxy]non-1-en-3-ol |
| SMILES | C=C[C@H](O)C[C@@H](CCCCOCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O4Si/c1-8-20(24)17-22(27-28(6,7)23(2,3)4)11-9-10-16-26-18-19-12-14-21(25-5)15-13-19/h8,12-15,20,22,24H,1,9-11,16-18H2,2-7H3/t20-,22+/m0/s1 |
| InChIKey | INGAYDCKJDUGHQ-RBBKRZOGSA-N |
| XLogP | 5.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|