C39H50O4Si — CID 15417385
tert-butyl-[6-[(4-methoxyphenyl)methoxy]-2-trityloxyhexoxy]-dimethylsilane (PubChem CID 15417385) has the molecular formula C39H50O4Si and a molecular weight of 610.91 g/mol. Its IUPAC name is tert-butyl-[6-[(4-methoxyphenyl)methoxy]-2-trityloxyhexoxy]-dimethylsilane.
| Compound Name | tert-butyl-[6-[(4-methoxyphenyl)methoxy]-2-trityloxyhexoxy]-dimethylsilane |
|---|---|
| PubChem CID | 15417385 |
| Molecular Formula | C39H50O4Si |
| Molecular Weight | 610.91 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | tert-butyl-[6-[(4-methoxyphenyl)methoxy]-2-trityloxyhexoxy]-dimethylsilane |
| SMILES | COc1ccc(COCCCCC(CO[Si](C)(C)C(C)(C)C)OC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H50O4Si/c1-38(2,3)44(5,6)42-31-37(24-16-17-29-41-30-32-25-27-36(40-4)28-26-32)43-39(33-18-10-7-11-19-33,34-20-12-8-13-21-34)35-22-14-9-15-23-35/h7-15,18-23,25-28,37H,16-17,24,29-31H2,1-6H3 |
| InChIKey | GXIXLTVVKAYPMH-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.91 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|