C26H40FNO5Si — CID 67931247
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[1-(4-fluorophenyl)-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-5-hydroxyhept-6-enoic acid (PubChem CID 67931247) has the molecular formula C26H40FNO5Si and a molecular weight of 493.69 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[1-(4-fluorophenyl)-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-5-hydroxyhept-6-enoic acid.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[1-(4-fluorophenyl)-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-5-hydroxyhept-6-enoic acid |
|---|---|
| PubChem CID | 67931247 |
| Molecular Formula | C26H40FNO5Si |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[1-(4-fluorophenyl)-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-5-hydroxyhept-6-enoic acid |
| SMILES | CC(C)C1CC(=O)N(c2ccc(F)cc2)C1C=CC(O)C[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H40FNO5Si/c1-17(2)22-16-24(30)28(19-10-8-18(27)9-11-19)23(22)13-12-20(29)14-21(15-25(31)32)33-34(6,7)26(3,4)5/h8-13,17,20-23,29H,14-16H2,1-7H3,(H,31,32)/t20?,21-,22?,23?/m1/s1 |
| InChIKey | CESVUIABPBQIGE-YQEOXULRSA-N |
| XLogP | 5.38 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|