C36H54FNO4Si2 — CID 90863885
(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]hept-6-enoic acid (PubChem CID 90863885) has the molecular formula C36H54FNO4Si2 and a molecular weight of 640.00 g/mol. Its IUPAC name is (3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]hept-6-enoic acid.
| Compound Name | (3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]hept-6-enoic acid |
|---|---|
| PubChem CID | 90863885 |
| Molecular Formula | C36H54FNO4Si2 |
| Molecular Weight | 640.00 g/mol |
| Exact Mass | 639.36 |
| IUPAC Name | (3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]hept-6-enoic acid |
| SMILES | CC(C)n1c(C=C[C@@H](C[C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)c(-c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C36H54FNO4Si2/c1-25(2)38-31-16-14-13-15-30(31)34(26-17-19-27(37)20-18-26)32(38)22-21-28(41-43(9,10)35(3,4)5)23-29(24-33(39)40)42-44(11,12)36(6,7)8/h13-22,25,28-29H,23-24H2,1-12H3,(H,39,40)/t28-,29-/m0/s1 |
| InChIKey | IBWQNMKEIQRKHY-VMPREFPWSA-N |
| XLogP | 10.69 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.00 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|