C33H47FNO5PSi — CID 91288366
(5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-1-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]hex-1-en-3-one (PubChem CID 91288366) has the molecular formula C33H47FNO5PSi and a molecular weight of 615.80 g/mol. Its IUPAC name is (5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-1-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]hex-1-en-3-one.
| Compound Name | (5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-1-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]hex-1-en-3-one |
|---|---|
| PubChem CID | 91288366 |
| Molecular Formula | C33H47FNO5PSi |
| Molecular Weight | 615.80 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | (5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-1-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]hex-1-en-3-one |
| SMILES | CCOP(=O)(C[C@@H](CC(=O)C=Cc1c(-c2ccc(F)cc2)c2ccccc2n1C(C)C)O[Si](C)(C)C(C)(C)C)OCC |
| InChI | InChI=1S/C33H47FNO5PSi/c1-10-38-41(37,39-11-2)23-28(40-42(8,9)33(5,6)7)22-27(36)20-21-31-32(25-16-18-26(34)19-17-25)29-14-12-13-15-30(29)35(31)24(3)4/h12-21,24,28H,10-11,22-23H2,1-9H3/t28-/m1/s1 |
| InChIKey | ZMHITPZMLZDHEY-MUUNZHRXSA-N |
| XLogP | 9.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.80 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|