C20H20FN — CID 18683567
3-(4-fluorophenyl)-1-propan-2-yl-2-[(E)-prop-1-enyl]indole (PubChem CID 18683567) has the molecular formula C20H20FN and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-propan-2-yl-2-[(E)-prop-1-enyl]indole.
| Compound Name | 3-(4-fluorophenyl)-1-propan-2-yl-2-[(E)-prop-1-enyl]indole |
|---|---|
| PubChem CID | 18683567 |
| Molecular Formula | C20H20FN |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-(4-fluorophenyl)-1-propan-2-yl-2-[(E)-prop-1-enyl]indole |
| SMILES | C/C=C/c1c(-c2ccc(F)cc2)c2ccccc2n1C(C)C |
| InChI | InChI=1S/C20H20FN/c1-4-7-19-20(15-10-12-16(21)13-11-15)17-8-5-6-9-18(17)22(19)14(2)3/h4-14H,1-3H3/b7-4+ |
| InChIKey | OZUDPOGNKJFQHL-QPJJXVBHSA-N |
| XLogP | 6.06 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |