C30H38FNO4Si — CID 68879648
(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-5-oxohept-6-enoic acid (PubChem CID 68879648) has the molecular formula C30H38FNO4Si and a molecular weight of 523.72 g/mol. Its IUPAC name is (E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-5-oxohept-6-enoic acid.
| Compound Name | (E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-5-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 68879648 |
| Molecular Formula | C30H38FNO4Si |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | (E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-5-oxohept-6-enoic acid |
| SMILES | CC(C)n1c(/C=C/C(=O)C[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)c(-c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C30H38FNO4Si/c1-20(2)32-26-11-9-8-10-25(26)29(21-12-14-22(31)15-13-21)27(32)17-16-23(33)18-24(19-28(34)35)36-37(6,7)30(3,4)5/h8-17,20,24H,18-19H2,1-7H3,(H,34,35)/b17-16+/t24-/m1/s1 |
| InChIKey | RMJLPGVPDLLHFI-GQRCBVMOSA-N |
| XLogP | 7.87 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|