C55H61FN2O4Si2 — CID 57324330
3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-7-[3-(4-fluorophenyl)-1-propan-2-ylpyrrolo[3,2-b]pyridin-2-yl]hept-6-enoic acid (PubChem CID 57324330) has the molecular formula C55H61FN2O4Si2 and a molecular weight of 889.27 g/mol. Its IUPAC name is 3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-7-[3-(4-fluorophenyl)-1-propan-2-ylpyrrolo[3,2-b]pyridin-2-yl]hept-6-enoic acid.
| Compound Name | 3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-7-[3-(4-fluorophenyl)-1-propan-2-ylpyrrolo[3,2-b]pyridin-2-yl]hept-6-enoic acid |
|---|---|
| PubChem CID | 57324330 |
| Molecular Formula | C55H61FN2O4Si2 |
| Molecular Weight | 889.27 g/mol |
| Exact Mass | 888.42 |
| IUPAC Name | 3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-7-[3-(4-fluorophenyl)-1-propan-2-ylpyrrolo[3,2-b]pyridin-2-yl]hept-6-enoic acid |
| SMILES | CC(C)n1c(C=CC(CC(CC(=O)O)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(-c2ccc(F)cc2)c2ncccc21 |
| InChI | InChI=1S/C55H61FN2O4Si2/c1-40(2)58-49(52(41-31-33-42(56)34-32-41)53-50(58)30-21-37-57-53)36-35-43(61-63(54(3,4)5,45-22-13-9-14-23-45)46-24-15-10-16-25-46)38-44(39-51(59)60)62-64(55(6,7)8,47-26-17-11-18-27-47)48-28-19-12-20-29-48/h9-37,40,43-44H,38-39H2,1-8H3,(H,59,60) |
| InChIKey | JVAIFUFPXPNVHN-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.27 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|