C40H47FNO5PSi — CID 54269271
(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]ethyl-methoxyphosphoryl]butanoic acid (PubChem CID 54269271) has the molecular formula C40H47FNO5PSi and a molecular weight of 699.88 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]ethyl-methoxyphosphoryl]butanoic acid.
| Compound Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]ethyl-methoxyphosphoryl]butanoic acid |
|---|---|
| PubChem CID | 54269271 |
| Molecular Formula | C40H47FNO5PSi |
| Molecular Weight | 699.88 g/mol |
| Exact Mass | 699.29 |
| IUPAC Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]ethyl-methoxyphosphoryl]butanoic acid |
| SMILES | COP(=O)(CCc1c(-c2ccc(F)cc2)c2ccccc2n1C(C)C)C[C@H](CC(=O)O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H47FNO5PSi/c1-29(2)42-36-20-14-13-19-35(36)39(30-21-23-31(41)24-22-30)37(42)25-26-48(45,46-6)28-32(27-38(43)44)47-49(40(3,4)5,33-15-9-7-10-16-33)34-17-11-8-12-18-34/h7-24,29,32H,25-28H2,1-6H3,(H,43,44)/t32-,48?/m0/s1 |
| InChIKey | RIZUDUJDOGQQEN-CKYSKPARSA-N |
| XLogP | 8.92 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.88 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|