C42H46FN2O5PSi — CID 19769496
3-[tert-butyl(diphenyl)silyl]oxy-4-[1-[4-(4-fluorophenyl)-2-phenyl-6-propan-2-ylpyrimidin-5-yl]ethenyl-methoxyphosphoryl]butanoic acid (PubChem CID 19769496) has the molecular formula C42H46FN2O5PSi and a molecular weight of 736.90 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-4-[1-[4-(4-fluorophenyl)-2-phenyl-6-propan-2-ylpyrimidin-5-yl]ethenyl-methoxyphosphoryl]butanoic acid.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-4-[1-[4-(4-fluorophenyl)-2-phenyl-6-propan-2-ylpyrimidin-5-yl]ethenyl-methoxyphosphoryl]butanoic acid |
|---|---|
| PubChem CID | 19769496 |
| Molecular Formula | C42H46FN2O5PSi |
| Molecular Weight | 736.90 g/mol |
| Exact Mass | 736.29 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-4-[1-[4-(4-fluorophenyl)-2-phenyl-6-propan-2-ylpyrimidin-5-yl]ethenyl-methoxyphosphoryl]butanoic acid |
| SMILES | C=C(c1c(-c2ccc(F)cc2)nc(-c2ccccc2)nc1C(C)C)P(=O)(CC(CC(=O)O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC |
| InChI | InChI=1S/C42H46FN2O5PSi/c1-29(2)39-38(40(31-23-25-33(43)26-24-31)45-41(44-39)32-17-11-8-12-18-32)30(3)51(48,49-7)28-34(27-37(46)47)50-52(42(4,5)6,35-19-13-9-14-20-35)36-21-15-10-16-22-36/h8-26,29,34H,3,27-28H2,1-2,4-7H3,(H,46,47) |
| InChIKey | JMIBNZOEOKQAHJ-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.90 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|