C43H46FN2O5PSi — CID 86746696
methyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[4-(4-fluorophenyl)-2-phenyl-6-propan-2-ylpyrimidin-5-yl]ethynyl-methoxyphosphoryl]butanoate (PubChem CID 86746696) has the molecular formula C43H46FN2O5PSi and a molecular weight of 748.91 g/mol. Its IUPAC name is methyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[4-(4-fluorophenyl)-2-phenyl-6-propan-2-ylpyrimidin-5-yl]ethynyl-methoxyphosphoryl]butanoate.
| Compound Name | methyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[4-(4-fluorophenyl)-2-phenyl-6-propan-2-ylpyrimidin-5-yl]ethynyl-methoxyphosphoryl]butanoate |
|---|---|
| PubChem CID | 86746696 |
| Molecular Formula | C43H46FN2O5PSi |
| Molecular Weight | 748.91 g/mol |
| Exact Mass | 748.29 |
| IUPAC Name | methyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[2-[4-(4-fluorophenyl)-2-phenyl-6-propan-2-ylpyrimidin-5-yl]ethynyl-methoxyphosphoryl]butanoate |
| SMILES | COC(=O)C[C@@H](CP(=O)(C#Cc1c(-c2ccc(F)cc2)nc(-c2ccccc2)nc1C(C)C)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C43H46FN2O5PSi/c1-31(2)40-38(41(32-23-25-34(44)26-24-32)46-42(45-40)33-17-11-8-12-18-33)27-28-52(48,50-7)30-35(29-39(47)49-6)51-53(43(3,4)5,36-19-13-9-14-20-36)37-21-15-10-16-22-37/h8-26,31,35H,29-30H2,1-7H3/t35-,52?/m0/s1 |
| InChIKey | MWHMLWJOTKSTJC-GQRCQZHNSA-N |
| XLogP | 8.81 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.91 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|