C44H49FNO5PSi — CID 67735711
(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[[(E)-2-[4-(4-fluoro-2-methylphenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethenyl]-methoxyphosphoryl]butanoic acid (PubChem CID 67735711) has the molecular formula C44H49FNO5PSi and a molecular weight of 749.94 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[[(E)-2-[4-(4-fluoro-2-methylphenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethenyl]-methoxyphosphoryl]butanoic acid.
| Compound Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[[(E)-2-[4-(4-fluoro-2-methylphenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethenyl]-methoxyphosphoryl]butanoic acid |
|---|---|
| PubChem CID | 67735711 |
| Molecular Formula | C44H49FNO5PSi |
| Molecular Weight | 749.94 g/mol |
| Exact Mass | 749.31 |
| IUPAC Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[[(E)-2-[4-(4-fluoro-2-methylphenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethenyl]-methoxyphosphoryl]butanoic acid |
| SMILES | COP(=O)(/C=C/c1c(-c2ccc(F)cc2C)cc(-c2ccccc2)nc1C(C)C)C[C@H](CC(=O)O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C44H49FNO5PSi/c1-31(2)43-39(40(38-24-23-34(45)27-32(38)3)29-41(46-43)33-17-11-8-12-18-33)25-26-52(49,50-7)30-35(28-42(47)48)51-53(44(4,5)6,36-19-13-9-14-20-36)37-21-15-10-16-22-37/h8-27,29,31,35H,28,30H2,1-7H3,(H,47,48)/b26-25+/t35-,52?/m0/s1 |
| InChIKey | KGZMMVWWXFKZDQ-KQFWWZMOSA-N |
| XLogP | 10.30 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.94 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|