C27H27FNO5P — CID 21471328
4-[2-[4-(4-fluoro-2-methylphenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid (PubChem CID 21471328) has the molecular formula C27H27FNO5P and a molecular weight of 495.49 g/mol. Its IUPAC name is 4-[2-[4-(4-fluoro-2-methylphenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid.
| Compound Name | 4-[2-[4-(4-fluoro-2-methylphenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 21471328 |
| Molecular Formula | C27H27FNO5P |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 4-[2-[4-(4-fluoro-2-methylphenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]ethynyl-hydroxyphosphoryl]-3-hydroxybutanoic acid |
| SMILES | Cc1cc(F)ccc1-c1cc(-c2ccccc2)nc(C(C)C)c1C#CP(=O)(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C27H27FNO5P/c1-17(2)27-23(11-12-35(33,34)16-21(30)14-26(31)32)24(22-10-9-20(28)13-18(22)3)15-25(29-27)19-7-5-4-6-8-19/h4-10,13,15,17,21,30H,14,16H2,1-3H3,(H,31,32)(H,33,34) |
| InChIKey | SYSRCRGUMNLOGN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|