C24H22FO5P — CID 54035229
(3S)-4-[2-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]ethynyl-methoxyphosphoryl]-3-hydroxybutanoic acid (PubChem CID 54035229) has the molecular formula C24H22FO5P and a molecular weight of 440.41 g/mol. Its IUPAC name is (3S)-4-[2-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]ethynyl-methoxyphosphoryl]-3-hydroxybutanoic acid.
| Compound Name | (3S)-4-[2-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]ethynyl-methoxyphosphoryl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 54035229 |
| Molecular Formula | C24H22FO5P |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (3S)-4-[2-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]ethynyl-methoxyphosphoryl]-3-hydroxybutanoic acid |
| SMILES | COP(=O)(C#Cc1c(C)cc2ccccc2c1-c1ccc(F)cc1)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C24H22FO5P/c1-16-13-18-5-3-4-6-22(18)24(17-7-9-19(25)10-8-17)21(16)11-12-31(29,30-2)15-20(26)14-23(27)28/h3-10,13,20,26H,14-15H2,1-2H3,(H,27,28)/t20-,31?/m0/s1 |
| InChIKey | LILQEPVZROIGMJ-MFYZJFEASA-N |
| XLogP | 5.02 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|