C23H22FO5P — CID 57020376
4-[2-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]ethyl-hydroxyphosphoryl]-3-oxobutanoic acid (PubChem CID 57020376) has the molecular formula C23H22FO5P and a molecular weight of 428.40 g/mol. Its IUPAC name is 4-[2-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]ethyl-hydroxyphosphoryl]-3-oxobutanoic acid.
| Compound Name | 4-[2-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]ethyl-hydroxyphosphoryl]-3-oxobutanoic acid |
|---|---|
| PubChem CID | 57020376 |
| Molecular Formula | C23H22FO5P |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-[2-[1-(4-fluorophenyl)-3-methylnaphthalen-2-yl]ethyl-hydroxyphosphoryl]-3-oxobutanoic acid |
| SMILES | Cc1cc2ccccc2c(-c2ccc(F)cc2)c1CCP(=O)(O)CC(=O)CC(=O)O |
| InChI | InChI=1S/C23H22FO5P/c1-15-12-17-4-2-3-5-21(17)23(16-6-8-18(24)9-7-16)20(15)10-11-30(28,29)14-19(25)13-22(26)27/h2-9,12H,10-11,13-14H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | KBDZWCCLNJMHCX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|