C27H29FNO5P — CID 57080414
4-[2-[2-ethyl-4-(4-fluorophenyl)-5-methyl-6-phenyl-3-pyridinyl]ethyl-methoxyphosphoryl]-3-oxobutanoic acid (PubChem CID 57080414) has the molecular formula C27H29FNO5P and a molecular weight of 497.50 g/mol. Its IUPAC name is 4-[2-[2-ethyl-4-(4-fluorophenyl)-5-methyl-6-phenyl-3-pyridinyl]ethyl-methoxyphosphoryl]-3-oxobutanoic acid.
| Compound Name | 4-[2-[2-ethyl-4-(4-fluorophenyl)-5-methyl-6-phenyl-3-pyridinyl]ethyl-methoxyphosphoryl]-3-oxobutanoic acid |
|---|---|
| PubChem CID | 57080414 |
| Molecular Formula | C27H29FNO5P |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 4-[2-[2-ethyl-4-(4-fluorophenyl)-5-methyl-6-phenyl-3-pyridinyl]ethyl-methoxyphosphoryl]-3-oxobutanoic acid |
| SMILES | CCc1nc(-c2ccccc2)c(C)c(-c2ccc(F)cc2)c1CCP(=O)(CC(=O)CC(=O)O)OC |
| InChI | InChI=1S/C27H29FNO5P/c1-4-24-23(14-15-35(33,34-3)17-22(30)16-25(31)32)26(19-10-12-21(28)13-11-19)18(2)27(29-24)20-8-6-5-7-9-20/h5-13H,4,14-17H2,1-3H3,(H,31,32) |
| InChIKey | OQZCKRUYRVXUPJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|