C25H25FNO5P — CID 57085769
4-[2-[4-(4-fluoro-3-methylphenyl)-2-propan-2-ylquinolin-3-yl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid (PubChem CID 57085769) has the molecular formula C25H25FNO5P and a molecular weight of 469.45 g/mol. Its IUPAC name is 4-[2-[4-(4-fluoro-3-methylphenyl)-2-propan-2-ylquinolin-3-yl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid.
| Compound Name | 4-[2-[4-(4-fluoro-3-methylphenyl)-2-propan-2-ylquinolin-3-yl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid |
|---|---|
| PubChem CID | 57085769 |
| Molecular Formula | C25H25FNO5P |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 4-[2-[4-(4-fluoro-3-methylphenyl)-2-propan-2-ylquinolin-3-yl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid |
| SMILES | Cc1cc(-c2c(C=CP(=O)(O)CC(=O)CC(=O)O)c(C(C)C)nc3ccccc23)ccc1F |
| InChI | InChI=1S/C25H25FNO5P/c1-15(2)25-20(10-11-33(31,32)14-18(28)13-23(29)30)24(17-8-9-21(26)16(3)12-17)19-6-4-5-7-22(19)27-25/h4-12,15H,13-14H2,1-3H3,(H,29,30)(H,31,32) |
| InChIKey | RRITYJUGTBMZQG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|