C25H25FO5 — CID 67917944
7-[3-(4-fluoro-3-methylphenyl)-7-propan-2-yl-1-benzofuran-2-yl]-3-hydroxy-5-oxohept-6-enoic acid (PubChem CID 67917944) has the molecular formula C25H25FO5 and a molecular weight of 424.47 g/mol. Its IUPAC name is 7-[3-(4-fluoro-3-methylphenyl)-7-propan-2-yl-1-benzofuran-2-yl]-3-hydroxy-5-oxohept-6-enoic acid.
| Compound Name | 7-[3-(4-fluoro-3-methylphenyl)-7-propan-2-yl-1-benzofuran-2-yl]-3-hydroxy-5-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 67917944 |
| Molecular Formula | C25H25FO5 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 7-[3-(4-fluoro-3-methylphenyl)-7-propan-2-yl-1-benzofuran-2-yl]-3-hydroxy-5-oxohept-6-enoic acid |
| SMILES | Cc1cc(-c2c(C=CC(=O)CC(O)CC(=O)O)oc3c(C(C)C)cccc23)ccc1F |
| InChI | InChI=1S/C25H25FO5/c1-14(2)19-5-4-6-20-24(16-7-9-21(26)15(3)11-16)22(31-25(19)20)10-8-17(27)12-18(28)13-23(29)30/h4-11,14,18,28H,12-13H2,1-3H3,(H,29,30) |
| InChIKey | VPFQLIXWEAEMAI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|