C13H17FO2 — CID 42073479
(3S)-3-(4-fluoro-3-methylphenyl)-4-methylpentanoic acid (PubChem CID 42073479) has the molecular formula C13H17FO2 and a molecular weight of 224.27 g/mol. Its IUPAC name is (3S)-3-(4-fluoro-3-methylphenyl)-4-methylpentanoic acid.
| Compound Name | (3S)-3-(4-fluoro-3-methylphenyl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 42073479 |
| Molecular Formula | C13H17FO2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (3S)-3-(4-fluoro-3-methylphenyl)-4-methylpentanoic acid |
| SMILES | Cc1cc([C@@H](CC(=O)O)C(C)C)ccc1F |
| InChI | InChI=1S/C13H17FO2/c1-8(2)11(7-13(15)16)10-4-5-12(14)9(3)6-10/h4-6,8,11H,7H2,1-3H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | HFWPCJWCQKTWKM-NSHDSACASA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |